About 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide
2-(2-aminoethyl)-1,3-thiazole-4-carboxamide (PubChem CID 3890422) has the molecular formula C6H9N3OS
and a molecular weight of 171.22 g/mol. Its IUPAC name is 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 3890422 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCCc1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C6H9N3OS/c7-2-1-5-9-4(3-11-5)6(8)10/h3H,1-2,7H2,(H2,8,10) |
| InChIKey | JOAMSFJXHWQWDX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide (CID 3890422) is 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide is NCCc1nc(C(N)=O)cs1.
What is the InChIKey of 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide?
The InChIKey is JOAMSFJXHWQWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS/c7-2-1-5-9-4(3-11-5)6(8)10/h3H,1-2,7H2,(H2,8,10).
What are the key properties of 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide?
2-(2-aminoethyl)-1,3-thiazole-4-carboxamide has a molecular weight of 171.22 g/mol, XLogP of -0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 3890422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).