C27H30N6O3 — CID 3890507
6-imino-11-methyl-N-[(4-methylphenyl)methyl]-7-(2-morpholin-4-ylethyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 3890507) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is 6-imino-11-methyl-N-[(4-methylphenyl)methyl]-7-(2-morpholin-4-ylethyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 6-imino-11-methyl-N-[(4-methylphenyl)methyl]-7-(2-morpholin-4-ylethyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 3890507 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 6-imino-11-methyl-N-[(4-methylphenyl)methyl]-7-(2-morpholin-4-ylethyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)NCc2ccc(C)cc2)cc2c(=O)n3cccc(C)c3nc2n1CCN1CCOCC1 |
| InChI | InChI=1S/C27H30N6O3/c1-18-5-7-20(8-6-18)17-29-26(34)21-16-22-25(30-24-19(2)4-3-9-33(24)27(22)35)32(23(21)28)11-10-31-12-14-36-15-13-31/h3-9,16,28H,10-15,17H2,1-2H3,(H,29,34)/b28-23+ |
| InChIKey | DLAJSEWWDJDAMX-WEMUOSSPSA-N |
| XLogP | 2.01 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|