About N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide
N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide (PubChem CID 38917009) has the molecular formula C25H26N2O4
and a molecular weight of 418.49 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide |
| PubChem CID | 38917009 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide |
| SMILES | CCCc1cc(=O)oc2cc(OCC(=O)N(CCC#N)c3ccc(C)c(C)c3)ccc12 |
| InChI | InChI=1S/C25H26N2O4/c1-4-6-19-14-25(29)31-23-15-21(9-10-22(19)23)30-16-24(28)27(12-5-11-26)20-8-7-17(2)18(3)13-20/h7-10,13-15H,4-6,12,16H2,1-3H3 |
| InChIKey | WRJBOQGVLMCSSG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide?
The IUPAC name of N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide (CID 38917009) is N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide.
What is the SMILES notation for N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide?
The canonical SMILES for N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide is CCCc1cc(=O)oc2cc(OCC(=O)N(CCC#N)c3ccc(C)c(C)c3)ccc12.
What is the InChIKey of N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide?
The InChIKey is WRJBOQGVLMCSSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O4/c1-4-6-19-14-25(29)31-23-15-21(9-10-22(19)23)30-16-24(28)27(12-5-11-26)20-8-7-17(2)18(3)13-20/h7-10,13-15H,4-6,12,16H2,1-3H3.
What are the key properties of N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide?
N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide has a molecular weight of 418.49 g/mol, XLogP of 4.69, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-N-(3,4-dimethylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide is sourced from PubChem (CID 38917009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).