C18H15IN2O5 — CID 38922652
2-iodo-5-nitro-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide (PubChem CID 38922652) has the molecular formula C18H15IN2O5 and a molecular weight of 466.23 g/mol. Its IUPAC name is 2-iodo-5-nitro-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide.
| Compound Name | 2-iodo-5-nitro-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide |
|---|---|
| PubChem CID | 38922652 |
| Molecular Formula | C18H15IN2O5 |
| Molecular Weight | 466.23 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 2-iodo-5-nitro-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OC1(CCCC1)O2)c1cc([N+](=O)[O-])ccc1I |
| InChI | InChI=1S/C18H15IN2O5/c19-14-5-4-12(21(23)24)10-13(14)17(22)20-11-3-6-15-16(9-11)26-18(25-15)7-1-2-8-18/h3-6,9-10H,1-2,7-8H2,(H,20,22) |
| InChIKey | XZNJJEADNQFYPV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|