About [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate
[2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate (PubChem CID 3892919) has the molecular formula C14H10BrNO3
and a molecular weight of 320.14 g/mol. Its IUPAC name is [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate.
Molecular Properties
| Compound Name | [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate |
| PubChem CID | 3892919 |
| Molecular Formula | C14H10BrNO3 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate |
| SMILES | O=C(OCC(=O)c1ccccc1Br)c1ccncc1 |
| InChI | InChI=1S/C14H10BrNO3/c15-12-4-2-1-3-11(12)13(17)9-19-14(18)10-5-7-16-8-6-10/h1-8H,9H2 |
| InChIKey | LEOTVOCHEGBIPB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate?
The IUPAC name of [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate (CID 3892919) is [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate.
What is the SMILES notation for [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate?
The canonical SMILES for [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate is O=C(OCC(=O)c1ccccc1Br)c1ccncc1.
What is the InChIKey of [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate?
The InChIKey is LEOTVOCHEGBIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrNO3/c15-12-4-2-1-3-11(12)13(17)9-19-14(18)10-5-7-16-8-6-10/h1-8H,9H2.
What are the key properties of [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate?
[2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate has a molecular weight of 320.14 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-bromophenyl)-2-oxoethyl] pyridine-4-carboxylate is sourced from PubChem (CID 3892919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).