About 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole
5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole (PubChem CID 3893012) has the molecular formula C18H19F2N
and a molecular weight of 287.35 g/mol. Its IUPAC name is 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole |
| PubChem CID | 3893012 |
| Molecular Formula | C18H19F2N |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole |
| SMILES | CC(C)(C)c1ccc2c(c1)CC(c1cc(F)ccc1F)N2 |
| InChI | InChI=1S/C18H19F2N/c1-18(2,3)12-4-7-16-11(8-12)9-17(21-16)14-10-13(19)5-6-15(14)20/h4-8,10,17,21H,9H2,1-3H3 |
| InChIKey | XDJUWWGZILOZGC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole?
The IUPAC name of 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole (CID 3893012) is 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole?
The canonical SMILES for 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole is CC(C)(C)c1ccc2c(c1)CC(c1cc(F)ccc1F)N2.
What is the InChIKey of 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole?
The InChIKey is XDJUWWGZILOZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2N/c1-18(2,3)12-4-7-16-11(8-12)9-17(21-16)14-10-13(19)5-6-15(14)20/h4-8,10,17,21H,9H2,1-3H3.
What are the key properties of 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole?
5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole has a molecular weight of 287.35 g/mol, XLogP of 4.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-(2,5-difluorophenyl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 3893012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).