C17H13BrFNO2 — CID 38930964
7-bromo-N-[2-(3-fluorophenyl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 38930964) has the molecular formula C17H13BrFNO2 and a molecular weight of 362.20 g/mol. Its IUPAC name is 7-bromo-N-[2-(3-fluorophenyl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-bromo-N-[2-(3-fluorophenyl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 38930964 |
| Molecular Formula | C17H13BrFNO2 |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 7-bromo-N-[2-(3-fluorophenyl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCc1cccc(F)c1)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C17H13BrFNO2/c18-14-6-2-4-12-10-15(22-16(12)14)17(21)20-8-7-11-3-1-5-13(19)9-11/h1-6,9-10H,7-8H2,(H,20,21) |
| InChIKey | UKZLPLBVOYEYQT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |