About 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate
2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate (PubChem CID 3893137) has the molecular formula C19H28N2O4
and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate.
Molecular Properties
| Compound Name | 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate |
| PubChem CID | 3893137 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate |
| SMILES | CCOCCO/C(=N\C(=O)c1ccc(C)cc1)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C19H28N2O4/c1-5-23-10-11-24-19(21-12-15(3)25-16(4)13-21)20-18(22)17-8-6-14(2)7-9-17/h6-9,15-16H,5,10-13H2,1-4H3/b20-19- |
| InChIKey | PQTJUIAFODNZRL-VXPUYCOJSA-N |
| XLogP | 2.65 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate?
The IUPAC name of 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate (CID 3893137) is 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate.
What is the SMILES notation for 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate?
The canonical SMILES for 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate is CCOCCO/C(=N\C(=O)c1ccc(C)cc1)N1CC(C)OC(C)C1.
What is the InChIKey of 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate?
The InChIKey is PQTJUIAFODNZRL-VXPUYCOJSA-N. The full InChI is InChI=1S/C19H28N2O4/c1-5-23-10-11-24-19(21-12-15(3)25-16(4)13-21)20-18(22)17-8-6-14(2)7-9-17/h6-9,15-16H,5,10-13H2,1-4H3/b20-19-.
What are the key properties of 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate?
2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate has a molecular weight of 348.44 g/mol, XLogP of 2.65, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 2,6-dimethyl-N-(4-methylbenzoyl)morpholine-4-carboximidate is sourced from PubChem (CID 3893137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).