C21H22F3N3O5S — CID 3893599
methyl 2-[[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(pyridine-4-carbonylamino)propan-2-yl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3893599) has the molecular formula C21H22F3N3O5S and a molecular weight of 485.48 g/mol. Its IUPAC name is methyl 2-[[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(pyridine-4-carbonylamino)propan-2-yl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(pyridine-4-carbonylamino)propan-2-yl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3893599 |
| Molecular Formula | C21H22F3N3O5S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | methyl 2-[[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(pyridine-4-carbonylamino)propan-2-yl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)C(NC(=O)c1ccncc1)(Nc1sc2c(c1C(=O)OC)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C21H22F3N3O5S/c1-3-32-19(30)20(21(22,23)24,26-16(28)12-8-10-25-11-9-12)27-17-15(18(29)31-2)13-6-4-5-7-14(13)33-17/h8-11,27H,3-7H2,1-2H3,(H,26,28) |
| InChIKey | ZKGXARCLKRCXHW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|