C18H21N3O6S — CID 3894134
methyl 2-[N-(4-ethoxyphenyl)-C-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)carbonimidoyl]sulfanylacetate (PubChem CID 3894134) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is methyl 2-[N-(4-ethoxyphenyl)-C-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)carbonimidoyl]sulfanylacetate.
| Compound Name | methyl 2-[N-(4-ethoxyphenyl)-C-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)carbonimidoyl]sulfanylacetate |
|---|---|
| PubChem CID | 3894134 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | methyl 2-[N-(4-ethoxyphenyl)-C-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)carbonimidoyl]sulfanylacetate |
| SMILES | CCOc1ccc(/N=C(\SCC(=O)OC)c2c(O)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C18H21N3O6S/c1-5-27-12-8-6-11(7-9-12)19-15(28-10-13(22)26-4)14-16(23)20(2)18(25)21(3)17(14)24/h6-9,23H,5,10H2,1-4H3/b19-15- |
| InChIKey | ZMSTVGKSUXKCOA-CYVLTUHYSA-N |
| XLogP | 1.17 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|