C15H13FN2O4S — CID 38941439
3-fluoro-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide (PubChem CID 38941439) has the molecular formula C15H13FN2O4S and a molecular weight of 336.34 g/mol. Its IUPAC name is 3-fluoro-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 38941439 |
| Molecular Formula | C15H13FN2O4S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3-fluoro-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide |
| SMILES | O=C1OCCN1c1cccc(NS(=O)(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C15H13FN2O4S/c16-11-3-1-6-14(9-11)23(20,21)17-12-4-2-5-13(10-12)18-7-8-22-15(18)19/h1-6,9-10,17H,7-8H2 |
| InChIKey | FBTNNJQQEKKNHQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |