About 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one
1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one (PubChem CID 3894466) has the molecular formula C28H34N2O
and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one |
| PubChem CID | 3894466 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one |
| SMILES | CCCCCCCN1C(=O)C(C)=C(C)C1c1c(-c2ccccc2)n(C)c2ccccc12 |
| InChI | InChI=1S/C28H34N2O/c1-5-6-7-8-14-19-30-26(20(2)21(3)28(30)31)25-23-17-12-13-18-24(23)29(4)27(25)22-15-10-9-11-16-22/h9-13,15-18,26H,5-8,14,19H2,1-4H3 |
| InChIKey | ZHPQXWBUKAWDCA-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one?
The IUPAC name of 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one (CID 3894466) is 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one.
What is the SMILES notation for 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one?
The canonical SMILES for 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one is CCCCCCCN1C(=O)C(C)=C(C)C1c1c(-c2ccccc2)n(C)c2ccccc12.
What is the InChIKey of 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one?
The InChIKey is ZHPQXWBUKAWDCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N2O/c1-5-6-7-8-14-19-30-26(20(2)21(3)28(30)31)25-23-17-12-13-18-24(23)29(4)27(25)22-15-10-9-11-16-22/h9-13,15-18,26H,5-8,14,19H2,1-4H3.
What are the key properties of 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one?
1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one has a molecular weight of 414.59 g/mol, XLogP of 7.04, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptyl-3,4-dimethyl-2-(1-methyl-2-phenylindol-3-yl)-2H-pyrrol-5-one is sourced from PubChem (CID 3894466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).