C26H28N4O3 — CID 3895531
3-[2-(cyclohexen-1-yl)ethyl]-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-b]quinoxaline (PubChem CID 3895531) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-b]quinoxaline.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 3895531 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-b]quinoxaline |
| SMILES | COc1cc(-c2nc3nc4ccccc4nc3n2CCC2=CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H28N4O3/c1-31-21-15-18(16-22(32-2)23(21)33-3)25-29-24-26(28-20-12-8-7-11-19(20)27-24)30(25)14-13-17-9-5-4-6-10-17/h7-9,11-12,15-16H,4-6,10,13-14H2,1-3H3 |
| InChIKey | BZILCHRMLJAUJX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|