About N-(triphenyl-λ5-phosphanylidene)acetamide
N-(triphenyl-λ5-phosphanylidene)acetamide (PubChem CID 3896273) has the molecular formula C20H18NOP
and a molecular weight of 319.34 g/mol. Its IUPAC name is N-(triphenyl-λ5-phosphanylidene)acetamide.
Molecular Properties
| Compound Name | N-(triphenyl-λ5-phosphanylidene)acetamide |
| PubChem CID | 3896273 |
| Molecular Formula | C20H18NOP |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(triphenyl-λ5-phosphanylidene)acetamide |
| SMILES | CC(=O)N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18NOP/c1-17(22)21-23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3 |
| InChIKey | KAJKHIIEJCKTRG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-(triphenyl-λ5-phosphanylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(triphenyl-λ5-phosphanylidene)acetamide?
The IUPAC name of N-(triphenyl-λ5-phosphanylidene)acetamide (CID 3896273) is N-(triphenyl-λ5-phosphanylidene)acetamide.
What is the SMILES notation for N-(triphenyl-λ5-phosphanylidene)acetamide?
The canonical SMILES for N-(triphenyl-λ5-phosphanylidene)acetamide is CC(=O)N=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(triphenyl-λ5-phosphanylidene)acetamide?
The InChIKey is KAJKHIIEJCKTRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18NOP/c1-17(22)21-23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3.
What are the key properties of N-(triphenyl-λ5-phosphanylidene)acetamide?
N-(triphenyl-λ5-phosphanylidene)acetamide has a molecular weight of 319.34 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(triphenyl-λ5-phosphanylidene)acetamide is sourced from PubChem (CID 3896273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).