C31H38N2O2S — CID 3896430
N-(2-methylpropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-4-pentylbenzamide (PubChem CID 3896430) has the molecular formula C31H38N2O2S and a molecular weight of 502.72 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-4-pentylbenzamide.
| Compound Name | N-(2-methylpropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 3896430 |
| Molecular Formula | C31H38N2O2S |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | N-(2-methylpropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CC(=O)N2CCc3sccc3C2c2ccccc2)CC(C)C)cc1 |
| InChI | InChI=1S/C31H38N2O2S/c1-4-5-7-10-24-13-15-26(16-14-24)31(35)32(21-23(2)3)22-29(34)33-19-17-28-27(18-20-36-28)30(33)25-11-8-6-9-12-25/h6,8-9,11-16,18,20,23,30H,4-5,7,10,17,19,21-22H2,1-3H3 |
| InChIKey | HDSWFEUPEBMULG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|