C22H22N2O3S — CID 3896462
N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-3-(2-methylpropoxy)benzamide (PubChem CID 3896462) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-3-(2-methylpropoxy)benzamide.
| Compound Name | N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-3-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 3896462 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-3-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1cccc(C(=O)NC(=S)Nc2cccc3cc(O)ccc23)c1 |
| InChI | InChI=1S/C22H22N2O3S/c1-14(2)13-27-18-7-3-6-16(12-18)21(26)24-22(28)23-20-8-4-5-15-11-17(25)9-10-19(15)20/h3-12,14,25H,13H2,1-2H3,(H2,23,24,26,28) |
| InChIKey | JZCLBUNQZXJMBW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|