C15H20N4O2S2 — CID 3896874
[2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] N,N-diethylcarbamodithioate (PubChem CID 3896874) has the molecular formula C15H20N4O2S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 3896874 |
| Molecular Formula | C15H20N4O2S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)Nc1ncc2c(n1)CCCC2=O |
| InChI | InChI=1S/C15H20N4O2S2/c1-3-19(4-2)15(22)23-9-13(21)18-14-16-8-10-11(17-14)6-5-7-12(10)20/h8H,3-7,9H2,1-2H3,(H,16,17,18,21) |
| InChIKey | FLOGFNYUNFYUKB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|