About 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile
2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile (PubChem CID 3897097) has the molecular formula C22H24N2O2
and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile |
| PubChem CID | 3897097 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(C=C(C#N)C(=O)c2cc(C)n(C3CCCC3)c2C)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-15-12-21(16(2)24(15)19-6-4-5-7-19)22(25)18(14-23)13-17-8-10-20(26-3)11-9-17/h8-13,19H,4-7H2,1-3H3 |
| InChIKey | NPWCRLROZFOAIH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile?
The IUPAC name of 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile (CID 3897097) is 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile.
What is the SMILES notation for 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile?
The canonical SMILES for 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile is COc1ccc(C=C(C#N)C(=O)c2cc(C)n(C3CCCC3)c2C)cc1.
What is the InChIKey of 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile?
The InChIKey is NPWCRLROZFOAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2/c1-15-12-21(16(2)24(15)19-6-4-5-7-19)22(25)18(14-23)13-17-8-10-20(26-3)11-9-17/h8-13,19H,4-7H2,1-3H3.
What are the key properties of 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile?
2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile has a molecular weight of 348.45 g/mol, XLogP of 5.02, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopentyl-2,5-dimethylpyrrole-3-carbonyl)-3-(4-methoxyphenyl)prop-2-enenitrile is sourced from PubChem (CID 3897097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).