C26H30NO+ — CID 3897493
4-benzyl-3-ethyl-2,6-diphenylpiperidin-1-ium-4-ol (PubChem CID 3897493) has the molecular formula C26H30NO+ and a molecular weight of 372.53 g/mol. Its IUPAC name is 4-benzyl-3-ethyl-2,6-diphenylpiperidin-1-ium-4-ol.
| Compound Name | 4-benzyl-3-ethyl-2,6-diphenylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 3897493 |
| Molecular Formula | C26H30NO+ |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 4-benzyl-3-ethyl-2,6-diphenylpiperidin-1-ium-4-ol |
| SMILES | CCC1C(c2ccccc2)[NH2+]C(c2ccccc2)CC1(O)Cc1ccccc1 |
| InChI | InChI=1S/C26H29NO/c1-2-23-25(22-16-10-5-11-17-22)27-24(21-14-8-4-9-15-21)19-26(23,28)18-20-12-6-3-7-13-20/h3-17,23-25,27-28H,2,18-19H2,1H3/p+1 |
| InChIKey | KIXGFZRPUASEFM-UHFFFAOYSA-O |
| XLogP | 4.44 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |