C20H20O3S — CID 3897564
ethyl 6-(4-methylphenyl)-2-oxo-4-thiophen-2-ylcyclohex-3-ene-1-carboxylate (PubChem CID 3897564) has the molecular formula C20H20O3S and a molecular weight of 340.44 g/mol. Its IUPAC name is ethyl 6-(4-methylphenyl)-2-oxo-4-thiophen-2-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 6-(4-methylphenyl)-2-oxo-4-thiophen-2-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 3897564 |
| Molecular Formula | C20H20O3S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethyl 6-(4-methylphenyl)-2-oxo-4-thiophen-2-ylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2cccs2)CC1c1ccc(C)cc1 |
| InChI | InChI=1S/C20H20O3S/c1-3-23-20(22)19-16(14-8-6-13(2)7-9-14)11-15(12-17(19)21)18-5-4-10-24-18/h4-10,12,16,19H,3,11H2,1-2H3 |
| InChIKey | JWMOABHPEGOXNJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|