About 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate
4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate (PubChem CID 3897575) has the molecular formula C17H22N2O4
and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate |
| PubChem CID | 3897575 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate |
| SMILES | CCCCOC(=O)C1CN(c2ccccc2)N=C1C(=O)OCC |
| InChI | InChI=1S/C17H22N2O4/c1-3-5-11-23-16(20)14-12-19(13-9-7-6-8-10-13)18-15(14)17(21)22-4-2/h6-10,14H,3-5,11-12H2,1-2H3 |
| InChIKey | FELSOHPIGBXLIA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate?
The IUPAC name of 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate (CID 3897575) is 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate.
What is the SMILES notation for 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate?
The canonical SMILES for 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate is CCCCOC(=O)C1CN(c2ccccc2)N=C1C(=O)OCC.
What is the InChIKey of 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate?
The InChIKey is FELSOHPIGBXLIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O4/c1-3-5-11-23-16(20)14-12-19(13-9-7-6-8-10-13)18-15(14)17(21)22-4-2/h6-10,14H,3-5,11-12H2,1-2H3.
What are the key properties of 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate?
4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate has a molecular weight of 318.37 g/mol, XLogP of 2.39, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-butyl 5-O-ethyl 2-phenyl-3,4-dihydropyrazole-4,5-dicarboxylate is sourced from PubChem (CID 3897575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).