C22H23N3O8 — CID 3898253
ethyl 6-[5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]oxymethyl]-2-oxo-1,3-dihydroimidazol-4-yl]-6-oxohexanoate (PubChem CID 3898253) has the molecular formula C22H23N3O8 and a molecular weight of 457.44 g/mol. Its IUPAC name is ethyl 6-[5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]oxymethyl]-2-oxo-1,3-dihydroimidazol-4-yl]-6-oxohexanoate.
| Compound Name | ethyl 6-[5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]oxymethyl]-2-oxo-1,3-dihydroimidazol-4-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 3898253 |
| Molecular Formula | C22H23N3O8 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | ethyl 6-[5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]oxymethyl]-2-oxo-1,3-dihydroimidazol-4-yl]-6-oxohexanoate |
| SMILES | CCOC(=O)CCCCC(=O)c1[nH]c(=O)[nH]c1COC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H23N3O8/c1-2-32-17(27)10-6-5-9-16(26)19-15(23-22(31)24-19)12-33-18(28)11-25-20(29)13-7-3-4-8-14(13)21(25)30/h3-4,7-8H,2,5-6,9-12H2,1H3,(H2,23,24,31) |
| InChIKey | JVFPSLFGZNSFDZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 155.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|