About [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate
[(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate (PubChem CID 38988328) has the molecular formula C12H14BrNO4
and a molecular weight of 316.15 g/mol. Its IUPAC name is [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate.
Molecular Properties
| Compound Name | [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate |
| PubChem CID | 38988328 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate |
| SMILES | C[C@]1(c2ccc(Br)cc2)OC[C@H](COC(N)=O)O1 |
| InChI | InChI=1S/C12H14BrNO4/c1-12(8-2-4-9(13)5-3-8)17-7-10(18-12)6-16-11(14)15/h2-5,10H,6-7H2,1H3,(H2,14,15)/t10-,12-/m0/s1 |
| InChIKey | QSUUSSJYBHNMHY-JQWIXIFHSA-N |
| XLogP | 2.13 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate?
The IUPAC name of [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate (CID 38988328) is [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate.
What is the SMILES notation for [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate?
The canonical SMILES for [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate is C[C@]1(c2ccc(Br)cc2)OC[C@H](COC(N)=O)O1.
What is the InChIKey of [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate?
The InChIKey is QSUUSSJYBHNMHY-JQWIXIFHSA-N. The full InChI is InChI=1S/C12H14BrNO4/c1-12(8-2-4-9(13)5-3-8)17-7-10(18-12)6-16-11(14)15/h2-5,10H,6-7H2,1H3,(H2,14,15)/t10-,12-/m0/s1.
What are the key properties of [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate?
[(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate has a molecular weight of 316.15 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R)-2-(4-bromophenyl)-2-methyl-1,3-dioxolan-4-yl]methyl carbamate is sourced from PubChem (CID 38988328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).