About [(2S)-oxiran-2-yl]methyl prop-2-enoate
[(2S)-oxiran-2-yl]methyl prop-2-enoate (PubChem CID 38989045) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is [(2S)-oxiran-2-yl]methyl prop-2-enoate.
Molecular Properties
| Compound Name | [(2S)-oxiran-2-yl]methyl prop-2-enoate |
| PubChem CID | 38989045 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | [(2S)-oxiran-2-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OC[C@@H]1CO1 |
| InChI | InChI=1S/C6H8O3/c1-2-6(7)9-4-5-3-8-5/h2,5H,1,3-4H2/t5-/m0/s1 |
| InChIKey | RPQRDASANLAFCM-YFKPBYRVSA-N |
| XLogP | 0.11 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-oxiran-2-yl]methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-oxiran-2-yl]methyl prop-2-enoate?
The IUPAC name of [(2S)-oxiran-2-yl]methyl prop-2-enoate (CID 38989045) is [(2S)-oxiran-2-yl]methyl prop-2-enoate.
What is the SMILES notation for [(2S)-oxiran-2-yl]methyl prop-2-enoate?
The canonical SMILES for [(2S)-oxiran-2-yl]methyl prop-2-enoate is C=CC(=O)OC[C@@H]1CO1.
What is the InChIKey of [(2S)-oxiran-2-yl]methyl prop-2-enoate?
The InChIKey is RPQRDASANLAFCM-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H8O3/c1-2-6(7)9-4-5-3-8-5/h2,5H,1,3-4H2/t5-/m0/s1.
What are the key properties of [(2S)-oxiran-2-yl]methyl prop-2-enoate?
[(2S)-oxiran-2-yl]methyl prop-2-enoate has a molecular weight of 128.13 g/mol, XLogP of 0.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-oxiran-2-yl]methyl prop-2-enoate is sourced from PubChem (CID 38989045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).