C12H21NO3S — CID 3899063
2-cyclohexyl-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 3899063) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-cyclohexyl-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-cyclohexyl-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 3899063 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-cyclohexyl-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CC1CCCCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO3S/c14-12(8-10-4-2-1-3-5-10)13-11-6-7-17(15,16)9-11/h10-11H,1-9H2,(H,13,14) |
| InChIKey | PJCFKPQXVUMSHE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |