C24H22ClN3O2 — CID 3899423
[3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-chloropropanoate (PubChem CID 3899423) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-chloropropanoate.
| Compound Name | [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-chloropropanoate |
|---|---|
| PubChem CID | 3899423 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-chloropropanoate |
| SMILES | Cc1cccn2c(NCc3ccccc3)c(-c3cccc(OC(=O)C(C)Cl)c3)nc12 |
| InChI | InChI=1S/C24H22ClN3O2/c1-16-8-7-13-28-22(16)27-21(23(28)26-15-18-9-4-3-5-10-18)19-11-6-12-20(14-19)30-24(29)17(2)25/h3-14,17,26H,15H2,1-2H3 |
| InChIKey | CEBZSKXOIYBQGA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|