C21H23ClN2O3S — CID 38997678
(4aS,7aR)-4-(3-chloro-4-methylphenyl)-1-[(4-methylphenyl)methyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 38997678) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is (4aS,7aR)-4-(3-chloro-4-methylphenyl)-1-[(4-methylphenyl)methyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-4-(3-chloro-4-methylphenyl)-1-[(4-methylphenyl)methyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 38997678 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (4aS,7aR)-4-(3-chloro-4-methylphenyl)-1-[(4-methylphenyl)methyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | Cc1ccc(CN2CC(=O)N(c3ccc(C)c(Cl)c3)[C@@H]3CS(=O)(=O)C[C@@H]32)cc1 |
| InChI | InChI=1S/C21H23ClN2O3S/c1-14-3-6-16(7-4-14)10-23-11-21(25)24(17-8-5-15(2)18(22)9-17)20-13-28(26,27)12-19(20)23/h3-9,19-20H,10-13H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | UGIQFBPLGRJXRK-VQTJNVASSA-N |
| XLogP | 2.97 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |