C25H29N3O3 — CID 3900043
N-(2,3-dimethylcyclohexyl)-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide (PubChem CID 3900043) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 3900043 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide |
| SMILES | CC1CCCC(NC(=O)CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)C1C |
| InChI | InChI=1S/C25H29N3O3/c1-17-10-9-15-21(18(17)2)26-22(29)16-28-23(30)25(27-24(28)31,19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-8,11-14,17-18,21H,9-10,15-16H2,1-2H3,(H,26,29)(H,27,31) |
| InChIKey | ZBKUHMZZMFGGLW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|