About N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide
N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide (PubChem CID 3900079) has the molecular formula C21H26N2O4
and a molecular weight of 370.45 g/mol. Its IUPAC name is N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide.
Molecular Properties
| Compound Name | N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide |
| PubChem CID | 3900079 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide |
| SMILES | COc1ccc(NC(=O)CC(C)CC(=O)NCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-15(11-20(24)22-14-16-7-5-4-6-8-16)12-21(25)23-18-10-9-17(26-2)13-19(18)27-3/h4-10,13,15H,11-12,14H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | TZFHWZYLQGCEJB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide?
The IUPAC name of N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide (CID 3900079) is N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide.
What is the SMILES notation for N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide?
The canonical SMILES for N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide is COc1ccc(NC(=O)CC(C)CC(=O)NCc2ccccc2)c(OC)c1.
What is the InChIKey of N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide?
The InChIKey is TZFHWZYLQGCEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O4/c1-15(11-20(24)22-14-16-7-5-4-6-8-16)12-21(25)23-18-10-9-17(26-2)13-19(18)27-3/h4-10,13,15H,11-12,14H2,1-3H3,(H,22,24)(H,23,25).
What are the key properties of N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide?
N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide has a molecular weight of 370.45 g/mol, XLogP of 3.38, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-(2,4-dimethoxyphenyl)-3-methylpentanediamide is sourced from PubChem (CID 3900079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).