C25H20N2O5 — CID 3900137
4-(5-benzyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl)benzoic acid (PubChem CID 3900137) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 4-(5-benzyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl)benzoic acid.
| Compound Name | 4-(5-benzyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 3900137 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 4-(5-benzyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(C2C3C(=O)N(Cc4ccccc4)C(=O)C3ON2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2O5/c28-23-20-21(17-11-13-18(14-12-17)25(30)31)27(19-9-5-2-6-10-19)32-22(20)24(29)26(23)15-16-7-3-1-4-8-16/h1-14,20-22H,15H2,(H,30,31) |
| InChIKey | RGYDKIXXTXIIGP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|