About 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one
8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one (PubChem CID 3900641) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one.
Molecular Properties
| Compound Name | 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
| PubChem CID | 3900641 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
| SMILES | Cc1cc(=O)n2c(n1)SCCC2 |
| InChI | InChI=1S/C8H10N2OS/c1-6-5-7(11)10-3-2-4-12-8(10)9-6/h5H,2-4H2,1H3 |
| InChIKey | MJJKYZNYECUQCF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one?
The IUPAC name of 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one (CID 3900641) is 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one.
What is the SMILES notation for 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one?
The canonical SMILES for 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one is Cc1cc(=O)n2c(n1)SCCC2.
What is the InChIKey of 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one?
The InChIKey is MJJKYZNYECUQCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-6-5-7(11)10-3-2-4-12-8(10)9-6/h5H,2-4H2,1H3.
What are the key properties of 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one?
8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one has a molecular weight of 182.25 g/mol, XLogP of 1.05, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one is sourced from PubChem (CID 3900641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).