C24H28Cl2N4O3 — CID 39013591
(2R)-N-(3,4-dichlorophenyl)-1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperidine-2-carboxamide (PubChem CID 39013591) has the molecular formula C24H28Cl2N4O3 and a molecular weight of 491.42 g/mol. Its IUPAC name is (2R)-N-(3,4-dichlorophenyl)-1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperidine-2-carboxamide.
| Compound Name | (2R)-N-(3,4-dichlorophenyl)-1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 39013591 |
| Molecular Formula | C24H28Cl2N4O3 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (2R)-N-(3,4-dichlorophenyl)-1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperidine-2-carboxamide |
| SMILES | O=C(CN1CCCC[C@@H]1C(=O)Nc1ccc(Cl)c(Cl)c1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H28Cl2N4O3/c25-20-9-6-18(15-21(20)26)28-24(32)22-3-1-2-10-30(22)16-23(31)27-17-4-7-19(8-5-17)29-11-13-33-14-12-29/h4-9,15,22H,1-3,10-14,16H2,(H,27,31)(H,28,32)/t22-/m1/s1 |
| InChIKey | UBMZOMZBSWYYAK-JOCHJYFZSA-N |
| XLogP | 4.26 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|