About 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide
3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 3902865) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide.
Molecular Properties
| Compound Name | 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide |
| PubChem CID | 3902865 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1csc(NC(=O)CC(C)(C)C)n1 |
| InChI | InChI=1S/C10H16N2OS/c1-7-6-14-9(11-7)12-8(13)5-10(2,3)4/h6H,5H2,1-4H3,(H,11,12,13) |
| InChIKey | CSVJYHGYFHPUEI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide?
The IUPAC name of 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide (CID 3902865) is 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide.
What is the SMILES notation for 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide?
The canonical SMILES for 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide is Cc1csc(NC(=O)CC(C)(C)C)n1.
What is the InChIKey of 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide?
The InChIKey is CSVJYHGYFHPUEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-7-6-14-9(11-7)12-8(13)5-10(2,3)4/h6H,5H2,1-4H3,(H,11,12,13).
What are the key properties of 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide?
3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide has a molecular weight of 212.32 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-N-(4-methyl-1,3-thiazol-2-yl)butanamide is sourced from PubChem (CID 3902865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).