About N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide
N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 3903218) has the molecular formula C18H19N3OS
and a molecular weight of 325.44 g/mol. Its IUPAC name is N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide |
| PubChem CID | 3903218 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1csc(Nc2cccc3ccccc23)n1 |
| InChI | InChI=1S/C18H19N3OS/c1-3-21(4-2)17(22)16-12-23-18(20-16)19-15-11-7-9-13-8-5-6-10-14(13)15/h5-12H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | VVGJMVYMOROCKQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide?
The IUPAC name of N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide (CID 3903218) is N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide is CCN(CC)C(=O)c1csc(Nc2cccc3ccccc23)n1.
What is the InChIKey of N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide?
The InChIKey is VVGJMVYMOROCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3OS/c1-3-21(4-2)17(22)16-12-23-18(20-16)19-15-11-7-9-13-8-5-6-10-14(13)15/h5-12H,3-4H2,1-2H3,(H,19,20).
What are the key properties of N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide?
N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide has a molecular weight of 325.44 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-(naphthalen-1-ylamino)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 3903218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).