C23H21F2N3O3S — CID 3903693
4-[4-(difluoromethoxy)phenyl]-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 3903693) has the molecular formula C23H21F2N3O3S and a molecular weight of 457.50 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 3903693 |
| Molecular Formula | C23H21F2N3O3S |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(OC(F)F)cc2)n1N=C(C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H21F2N3O3S/c1-3-10-26-23-28(19(14-32-23)16-4-7-18(8-5-16)31-22(24)25)27-15(2)17-6-9-20-21(13-17)30-12-11-29-20/h3-9,13-14,22H,1,10-12H2,2H3/b26-23-,27-15? |
| InChIKey | YCRJHDQPWBISFP-MALKKSICSA-N |
| XLogP | 4.95 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|