About [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate
[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 3903794) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate.
Molecular Properties
| Compound Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate |
| PubChem CID | 3903794 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | CC1CC(C)CN(C(=O)COC(=O)c2ccc3ccccc3n2)C1 |
| InChI | InChI=1S/C19H22N2O3/c1-13-9-14(2)11-21(10-13)18(22)12-24-19(23)17-8-7-15-5-3-4-6-16(15)20-17/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | ORZVLJFUOJPCLT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate?
The IUPAC name of [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate (CID 3903794) is [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate.
What is the SMILES notation for [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate?
The canonical SMILES for [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate is CC1CC(C)CN(C(=O)COC(=O)c2ccc3ccccc3n2)C1.
What is the InChIKey of [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate?
The InChIKey is ORZVLJFUOJPCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-13-9-14(2)11-21(10-13)18(22)12-24-19(23)17-8-7-15-5-3-4-6-16(15)20-17/h3-8,13-14H,9-12H2,1-2H3.
What are the key properties of [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate?
[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate has a molecular weight of 326.40 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] quinoline-2-carboxylate is sourced from PubChem (CID 3903794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).