C20H19N5O5S — CID 39038270
1-[[2-(N-acetyl-2,4-dimethylanilino)-1,3-thiazol-4-yl]methyl]-5-nitro-2-oxopyridine-3-carboxamide (PubChem CID 39038270) has the molecular formula C20H19N5O5S and a molecular weight of 441.47 g/mol. Its IUPAC name is 1-[[2-(N-acetyl-2,4-dimethylanilino)-1,3-thiazol-4-yl]methyl]-5-nitro-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[[2-(N-acetyl-2,4-dimethylanilino)-1,3-thiazol-4-yl]methyl]-5-nitro-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 39038270 |
| Molecular Formula | C20H19N5O5S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 1-[[2-(N-acetyl-2,4-dimethylanilino)-1,3-thiazol-4-yl]methyl]-5-nitro-2-oxopyridine-3-carboxamide |
| SMILES | CC(=O)N(c1nc(Cn2cc([N+](=O)[O-])cc(C(N)=O)c2=O)cs1)c1ccc(C)cc1C |
| InChI | InChI=1S/C20H19N5O5S/c1-11-4-5-17(12(2)6-11)24(13(3)26)20-22-14(10-31-20)8-23-9-15(25(29)30)7-16(18(21)27)19(23)28/h4-7,9-10H,8H2,1-3H3,(H2,21,27) |
| InChIKey | MWKAWCUVXNTBNS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|