C25H24FN5O3 — CID 39038738
1-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-3-carboxamide (PubChem CID 39038738) has the molecular formula C25H24FN5O3 and a molecular weight of 461.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 39038738 |
| Molecular Formula | C25H24FN5O3 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-3-carboxamide |
| SMILES | COc1cc2c(cc1OC)-c1c(c(C(=O)NCCCn3ccnc3)nn1-c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C25H24FN5O3/c1-33-21-13-16-12-20-23(25(32)28-8-3-10-30-11-9-27-15-30)29-31(18-6-4-17(26)5-7-18)24(20)19(16)14-22(21)34-2/h4-7,9,11,13-15H,3,8,10,12H2,1-2H3,(H,28,32) |
| InChIKey | DONJULWLPOMDLG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|