C18H19N5O2S — CID 3904155
1-[3-[(4-methoxyphenyl)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-(4-methylphenyl)urea (PubChem CID 3904155) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 1-[3-[(4-methoxyphenyl)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[3-[(4-methoxyphenyl)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 3904155 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-[3-[(4-methoxyphenyl)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-(4-methylphenyl)urea |
| SMILES | COc1ccc(Cc2n[nH]c(=S)n2NC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H19N5O2S/c1-12-3-7-14(8-4-12)19-17(24)22-23-16(20-21-18(23)26)11-13-5-9-15(25-2)10-6-13/h3-10H,11H2,1-2H3,(H,21,26)(H2,19,22,24) |
| InChIKey | RDQBADNBPMQCKE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|