C15H12N2O5S — CID 3904435
1-amino-4-(methylamino)-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 3904435) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is 1-amino-4-(methylamino)-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-(methylamino)-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 3904435 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-amino-4-(methylamino)-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | CNc1cc(S(=O)(=O)O)c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H12N2O5S/c1-17-9-6-10(23(20,21)22)13(16)12-11(9)14(18)7-4-2-3-5-8(7)15(12)19/h2-6,17H,16H2,1H3,(H,20,21,22) |
| InChIKey | VXBXATQWJSKUFF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|