C20H26N4O5 — CID 39044851
4-[[3-[(S)-carboxy-(4-ethylpiperazin-1-yl)methyl]-1H-indol-6-yl]amino]-4-oxobutanoic acid (PubChem CID 39044851) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-[[3-[(S)-carboxy-(4-ethylpiperazin-1-yl)methyl]-1H-indol-6-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-[(S)-carboxy-(4-ethylpiperazin-1-yl)methyl]-1H-indol-6-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 39044851 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4-[[3-[(S)-carboxy-(4-ethylpiperazin-1-yl)methyl]-1H-indol-6-yl]amino]-4-oxobutanoic acid |
| SMILES | CCN1CCN([C@H](C(=O)O)c2c[nH]c3cc(NC(=O)CCC(=O)O)ccc23)CC1 |
| InChI | InChI=1S/C20H26N4O5/c1-2-23-7-9-24(10-8-23)19(20(28)29)15-12-21-16-11-13(3-4-14(15)16)22-17(25)5-6-18(26)27/h3-4,11-12,19,21H,2,5-10H2,1H3,(H,22,25)(H,26,27)(H,28,29)/t19-/m0/s1 |
| InChIKey | LHZKCVFVKNKNNE-IBGZPJMESA-N |
| XLogP | 1.73 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |