About ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate
ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate (PubChem CID 3904725) has the molecular formula C28H26N4O3
and a molecular weight of 466.54 g/mol. Its IUPAC name is ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate |
| PubChem CID | 3904725 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc3nc(-c4ccccc4)c(-c4ccccc4)nc3c2)CC1 |
| InChI | InChI=1S/C28H26N4O3/c1-2-35-28(34)32-17-15-31(16-18-32)27(33)22-13-14-23-24(19-22)30-26(21-11-7-4-8-12-21)25(29-23)20-9-5-3-6-10-20/h3-14,19H,2,15-18H2,1H3 |
| InChIKey | VIGFPAMVQSNDMA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate?
The IUPAC name of ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate (CID 3904725) is ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate is CCOC(=O)N1CCN(C(=O)c2ccc3nc(-c4ccccc4)c(-c4ccccc4)nc3c2)CC1.
What is the InChIKey of ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate?
The InChIKey is VIGFPAMVQSNDMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N4O3/c1-2-35-28(34)32-17-15-31(16-18-32)27(33)22-13-14-23-24(19-22)30-26(21-11-7-4-8-12-21)25(29-23)20-9-5-3-6-10-20/h3-14,19H,2,15-18H2,1H3.
What are the key properties of ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate?
ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate has a molecular weight of 466.54 g/mol, XLogP of 4.88, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,3-diphenylquinoxaline-6-carbonyl)piperazine-1-carboxylate is sourced from PubChem (CID 3904725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).