About 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide
6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide (PubChem CID 3904858) has the molecular formula C14H14N4O
and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide.
Molecular Properties
| Compound Name | 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide |
| PubChem CID | 3904858 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide |
| SMILES | NNC(=O)c1[nH]nc2c1CCC2=Cc1ccccc1 |
| InChI | InChI=1S/C14H14N4O/c15-16-14(19)13-11-7-6-10(12(11)17-18-13)8-9-4-2-1-3-5-9/h1-5,8H,6-7,15H2,(H,16,19)(H,17,18) |
| InChIKey | XIEWYWRCNYIOFV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide?
The IUPAC name of 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide (CID 3904858) is 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide.
What is the SMILES notation for 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide?
The canonical SMILES for 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide is NNC(=O)c1[nH]nc2c1CCC2=Cc1ccccc1.
What is the InChIKey of 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide?
The InChIKey is XIEWYWRCNYIOFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O/c15-16-14(19)13-11-7-6-10(12(11)17-18-13)8-9-4-2-1-3-5-9/h1-5,8H,6-7,15H2,(H,16,19)(H,17,18).
What are the key properties of 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide?
6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide has a molecular weight of 254.29 g/mol, XLogP of 1.50, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylidene-4,5-dihydro-2H-cyclopenta[c]pyrazole-3-carbohydrazide is sourced from PubChem (CID 3904858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).