About 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide
3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide (PubChem CID 39049006) has the molecular formula C9H14N6O2S
and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide.
Molecular Properties
| Compound Name | 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide |
| PubChem CID | 39049006 |
| Molecular Formula | C9H14N6O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)CCSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C9H14N6O2S/c1-12-8(17)15-7(16)2-3-18-9-13-5(10)4-6(11)14-9/h4H,2-3H2,1H3,(H4,10,11,13,14)(H2,12,15,16,17) |
| InChIKey | KMHJWMVWIABAGN-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide?
The IUPAC name of 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide (CID 39049006) is 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide.
What is the SMILES notation for 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide?
The canonical SMILES for 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide is CNC(=O)NC(=O)CCSc1nc(N)cc(N)n1.
What is the InChIKey of 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide?
The InChIKey is KMHJWMVWIABAGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N6O2S/c1-12-8(17)15-7(16)2-3-18-9-13-5(10)4-6(11)14-9/h4H,2-3H2,1H3,(H4,10,11,13,14)(H2,12,15,16,17).
What are the key properties of 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide?
3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide has a molecular weight of 270.32 g/mol, XLogP of -0.42, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(methylcarbamoyl)propanamide is sourced from PubChem (CID 39049006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).