C14H11BrN2O2 — CID 3905063
2-[2-[(4-bromophenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 3905063) has the molecular formula C14H11BrN2O2 and a molecular weight of 319.16 g/mol. Its IUPAC name is 2-[2-[(4-bromophenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-[2-[(4-bromophenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 3905063 |
| Molecular Formula | C14H11BrN2O2 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2-[2-[(4-bromophenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1NN=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H11BrN2O2/c15-11-7-5-10(6-8-11)9-16-17-13-4-2-1-3-12(13)14(18)19/h1-9,17H,(H,18,19) |
| InChIKey | AETLYHIFAZOEJJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|