C17H26N4O3S — CID 3905508
2-(propylamino)-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide (PubChem CID 3905508) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-(propylamino)-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(propylamino)-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3905508 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(propylamino)-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
| SMILES | CCCNCC(=O)Nc1cccc(S(=O)(=O)NC2=NCCCCC2)c1 |
| InChI | InChI=1S/C17H26N4O3S/c1-2-10-18-13-17(22)20-14-7-6-8-15(12-14)25(23,24)21-16-9-4-3-5-11-19-16/h6-8,12,18H,2-5,9-11,13H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | KBDSCFOYHAKDHF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|