About 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide
1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide (PubChem CID 39058444) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide |
| PubChem CID | 39058444 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide |
| SMILES | COC(CNC(=O)C1(N)CCCCC1)OC |
| InChI | InChI=1S/C11H22N2O3/c1-15-9(16-2)8-13-10(14)11(12)6-4-3-5-7-11/h9H,3-8,12H2,1-2H3,(H,13,14) |
| InChIKey | XMMOPDXHCHLYKH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide?
The IUPAC name of 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide (CID 39058444) is 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide.
What is the SMILES notation for 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide?
The canonical SMILES for 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide is COC(CNC(=O)C1(N)CCCCC1)OC.
What is the InChIKey of 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide?
The InChIKey is XMMOPDXHCHLYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-15-9(16-2)8-13-10(14)11(12)6-4-3-5-7-11/h9H,3-8,12H2,1-2H3,(H,13,14).
What are the key properties of 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide?
1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide has a molecular weight of 230.31 g/mol, XLogP of 0.38, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-N-(2,2-dimethoxyethyl)cyclohexane-1-carboxamide is sourced from PubChem (CID 39058444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).