C22H24ClN3O2 — CID 3905892
2-chloro-N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-methylacetamide (PubChem CID 3905892) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 2-chloro-N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-methylacetamide.
| Compound Name | 2-chloro-N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-methylacetamide |
|---|---|
| PubChem CID | 3905892 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-chloro-N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-methylacetamide |
| SMILES | CCC(c1nc2ccccc2c(=O)n1-c1ccc(C)c(C)c1)N(C)C(=O)CCl |
| InChI | InChI=1S/C22H24ClN3O2/c1-5-19(25(4)20(27)13-23)21-24-18-9-7-6-8-17(18)22(28)26(21)16-11-10-14(2)15(3)12-16/h6-12,19H,5,13H2,1-4H3 |
| InChIKey | IEQRDBYCSPVYBN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|