About 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide
6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide (PubChem CID 3906197) has the molecular formula C20H21F2N5O
and a molecular weight of 385.42 g/mol. Its IUPAC name is 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide |
| PubChem CID | 3906197 |
| Molecular Formula | C20H21F2N5O |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2cnn(-c3ccc(F)cc3F)c2)nc1 |
| InChI | InChI=1S/C20H21F2N5O/c1-26(2)9-3-8-23-20(28)14-4-6-18(24-11-14)15-12-25-27(13-15)19-7-5-16(21)10-17(19)22/h4-7,10-13H,3,8-9H2,1-2H3,(H,23,28) |
| InChIKey | QVLJLEDBKHOKMY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide?
The IUPAC name of 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide (CID 3906197) is 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide.
What is the SMILES notation for 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide?
The canonical SMILES for 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide is CN(C)CCCNC(=O)c1ccc(-c2cnn(-c3ccc(F)cc3F)c2)nc1.
What is the InChIKey of 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide?
The InChIKey is QVLJLEDBKHOKMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F2N5O/c1-26(2)9-3-8-23-20(28)14-4-6-18(24-11-14)15-12-25-27(13-15)19-7-5-16(21)10-17(19)22/h4-7,10-13H,3,8-9H2,1-2H3,(H,23,28).
What are the key properties of 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide?
6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide has a molecular weight of 385.42 g/mol, XLogP of 2.89, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(2,4-difluorophenyl)pyrazol-4-yl]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide is sourced from PubChem (CID 3906197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).