C13H18N4OS — CID 39063504
3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 39063504) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 39063504 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | Cc1ccc(OCCCSc2n[nH]c(N)n2)cc1C |
| InChI | InChI=1S/C13H18N4OS/c1-9-4-5-11(8-10(9)2)18-6-3-7-19-13-15-12(14)16-17-13/h4-5,8H,3,6-7H2,1-2H3,(H3,14,15,16,17) |
| InChIKey | WQZFYFYIHUTHOL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|